Products 1399103-21-9
CAS 1399103-21-9 appears in our catalog under these names: Asenapine O-sulfate, Asenapine Impurity 2 (Asenapine 11-Hydroxysulfate), Asenapine 11-Hydroxysulfate. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[(2R,6R)-17-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaen-9-yl] hydrogen sulfate (CAS 1399103-21-9) is a chemical compound with the molecular formula C17H16ClNO5S and a molecular weight of 381.8 g/mol. IUPAC name: [(2R,6R)-17-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaen-9-yl] hydrogen sulfate. InChIKey: MFUYPKMLVSJPJJ-GJZGRUSLSA-N.
| Molecular formula | C17H16ClNO5S |
|---|---|
| Molecular weight | 381.8 g/mol |
| IUPAC name | [(2R,6R)-17-chloro-4-methyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaen-9-yl] hydrogen sulfate |
| InChIKey | MFUYPKMLVSJPJJ-GJZGRUSLSA-N |
| SMILES | CN1C[C@@H]2[C@@H](C1)C3=C(C=CC(=C3)Cl)OC4=C2C=C(C=C4)OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Asenapine 11-Hydroxysulfate, Asenapine O-sulfate