Products 1399295-02-3
CAS 1399295-02-3 is the registry number for 3,3-Di(methyl-d3)-butanoyl-4,4,4-d3 Chloride. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
4,4,4-trideuterio-3,3-bis(trideuteriomethyl)butanoyl chloride (CAS 1399295-02-3) is a chemical compound with the molecular formula C6H11ClO and a molecular weight of 143.66 g/mol. IUPAC name: 4,4,4-trideuterio-3,3-bis(trideuteriomethyl)butanoyl chloride. InChIKey: BUTKIHRNYUEGKB-GQALSZNTSA-N.
| Molecular formula | C6H11ClO |
|---|---|
| Molecular weight | 143.66 g/mol |
| IUPAC name | 4,4,4-trideuterio-3,3-bis(trideuteriomethyl)butanoyl chloride |
| InChIKey | BUTKIHRNYUEGKB-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(CC(=O)Cl)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)