Products 1399662-91-9

CAS 1399662-91-9 is the registry number for 3-(4-Chlorofuran-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-chlorofuran-2-yl)propanoic acid (CAS 1399662-91-9) is a chemical compound with the molecular formula C7H7ClO3 and a molecular weight of 174.58 g/mol. IUPAC name: 3-(4-chlorofuran-2-yl)propanoic acid. InChIKey: AFFUEAYUKCNUSD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClO3
Molecular weight174.58 g/mol
IUPAC name3-(4-chlorofuran-2-yl)propanoic acid
InChIKeyAFFUEAYUKCNUSD-UHFFFAOYSA-N
SMILESC1=C(OC=C1Cl)CCC(=O)O

Computed by PubChem (NCBI)