CAS 139968-49-3 appears in our catalog under these names: Metaflumizone, >95% (HPLC), Metaflumizone, Metaflumizone 100 µg/mL in Acetonitrile, Metaflumizone/ 98%, METAFLUMIZONE, TECHNICAL PESTANAL. Offered by: TRC, Dr. Ehrenstorfer, TargetMol, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 50mg, 1ml, 500mg, 10mM/1mL, 500 mg, 100 mg.
1-[(E)-[2-(4-cyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea (CAS 139968-49-3) is a chemical compound with the molecular formula C24H16F6N4O2 and a molecular weight of 506.4 g/mol. IUPAC name: 1-[(E)-[2-(4-cyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea. InChIKey: MIFOMMKAVSCNKQ-QNKGDIEWSA-N.
| Molecular formula | C24H16F6N4O2 |
|---|---|
| Molecular weight | 506.4 g/mol |
| IUPAC name | 1-[(E)-[2-(4-cyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea |
| InChIKey | MIFOMMKAVSCNKQ-QNKGDIEWSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C(=N/NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)/CC3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)