CAS 1399767-47-5 is the registry number for RO5464466. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[(1R,5S)-5-hydroxy-1,3,3-trimethylcyclohexyl]methylamino]benzenesulfonamide (CAS 1399767-47-5) is a chemical compound with the molecular formula C16H26N2O3S and a molecular weight of 326.5 g/mol. IUPAC name: 3-[[(1R,5S)-5-hydroxy-1,3,3-trimethylcyclohexyl]methylamino]benzenesulfonamide. InChIKey: UDLUYVVEARTGHQ-BBRMVZONSA-N.
| Molecular formula | C16H26N2O3S |
|---|---|
| Molecular weight | 326.5 g/mol |
| IUPAC name | 3-[[(1R,5S)-5-hydroxy-1,3,3-trimethylcyclohexyl]methylamino]benzenesulfonamide |
| InChIKey | UDLUYVVEARTGHQ-BBRMVZONSA-N |
| SMILES | C[C@@]1(C[C@H](CC(C1)(C)C)O)CNC2=CC(=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)