Products 1400580-27-9
CAS 1400580-27-9 is the registry number for tert-Butyl (3R,4R)-4-amino-3-ethylpiperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4R)-4-amino-3-ethylpiperidine-1-carboxylate (CAS 1400580-27-9) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (3R,4R)-4-amino-3-ethylpiperidine-1-carboxylate. InChIKey: XYJMNRWKGUVPQP-NXEZZACHSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-amino-3-ethylpiperidine-1-carboxylate |
| InChIKey | XYJMNRWKGUVPQP-NXEZZACHSA-N |
| SMILES | CC[C@@H]1CN(CC[C@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)