CAS 1400635-37-1 is the registry number for Boc-d-isogln-ala-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2R)-2-[[(4S)-5-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]propanoic acid (CAS 1400635-37-1) is a chemical compound with the molecular formula C13H23N3O6 and a molecular weight of 317.34 g/mol. IUPAC name: (2R)-2-[[(4S)-5-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]propanoic acid. InChIKey: RUCOEDMQVPNIDV-SFYZADRCSA-N.
| Molecular formula | C13H23N3O6 |
|---|---|
| Molecular weight | 317.34 g/mol |
| IUPAC name | (2R)-2-[[(4S)-5-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]amino]propanoic acid |
| InChIKey | RUCOEDMQVPNIDV-SFYZADRCSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)CC[C@@H](C(=O)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)