CAS 1400644-73-6 appears in our catalog under these names: 4-Bromo-5-chloro-2-(cyclopropylmethoxy)aniline hydrochloride, 96%, 4-Bromo-5-chloro-2-(cyclopropylmethoxy)aniline HCl, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
4-bromo-5-chloro-2-(cyclopropylmethoxy)aniline;hydrochloride (CAS 1400644-73-6) is a chemical compound with the molecular formula C10H12BrCl2NO and a molecular weight of 313.01 g/mol. IUPAC name: 4-bromo-5-chloro-2-(cyclopropylmethoxy)aniline;hydrochloride. InChIKey: YUKQABSLVSSTPK-UHFFFAOYSA-N.
| Molecular formula | C10H12BrCl2NO |
|---|---|
| Molecular weight | 313.01 g/mol |
| IUPAC name | 4-bromo-5-chloro-2-(cyclopropylmethoxy)aniline;hydrochloride |
| InChIKey | YUKQABSLVSSTPK-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=CC(=C(C=C2N)Cl)Br.Cl |
Computed by PubChem (NCBI)