CAS 1400644-86-1 is the registry number for Benzyl[2-(3-bromophenyl)propan-2-yl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
N-benzyl-2-(3-bromophenyl)propan-2-amine;hydrochloride (CAS 1400644-86-1) is a chemical compound with the molecular formula C16H19BrClN and a molecular weight of 340.7 g/mol. IUPAC name: N-benzyl-2-(3-bromophenyl)propan-2-amine;hydrochloride. InChIKey: ATYLHONHEKLBPE-UHFFFAOYSA-N.
| Molecular formula | C16H19BrClN |
|---|---|
| Molecular weight | 340.7 g/mol |
| IUPAC name | N-benzyl-2-(3-bromophenyl)propan-2-amine;hydrochloride |
| InChIKey | ATYLHONHEKLBPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)Br)NCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)