CAS 1400702-00-2 appears in our catalog under these names: 6-Bromo-4-fluoro-2,3-dihydro-1H-indene, 98%, 6-Bromo-4-fluoro-2,3-dihydro-1H-indene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-4-fluoro-2,3-dihydro-1H-indene (CAS 1400702-00-2) is a chemical compound with the molecular formula C9H8BrF and a molecular weight of 215.06 g/mol. IUPAC name: 6-bromo-4-fluoro-2,3-dihydro-1H-indene. InChIKey: CHZUTJPIXUQKQP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | 6-bromo-4-fluoro-2,3-dihydro-1H-indene |
| InChIKey | CHZUTJPIXUQKQP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC(=C2)Br)F |
Computed by PubChem (NCBI)