CAS 1400808-30-1 is the registry number for tert–butyl 2–amino–3–cyano–5–fluoro–1H–indol–7–yl(methyl)carbamate. Offered by: GLPBio. Available pack sizes: 200mg.
Tert-butyl N-(2-amino-3-cyano-5-fluoro-1H-indol-7-yl)-N-methylcarbamate (CAS 1400808-30-1) is a chemical compound with the molecular formula C15H17FN4O2 and a molecular weight of 304.32 g/mol. IUPAC name: tert-butyl N-(2-amino-3-cyano-5-fluoro-1H-indol-7-yl)-N-methylcarbamate. InChIKey: VARHTVWSJWDTKW-UHFFFAOYSA-N.
| Molecular formula | C15H17FN4O2 |
|---|---|
| Molecular weight | 304.32 g/mol |
| IUPAC name | tert-butyl N-(2-amino-3-cyano-5-fluoro-1H-indol-7-yl)-N-methylcarbamate |
| InChIKey | VARHTVWSJWDTKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=CC2=C1NC(=C2C#N)N)F |
Computed by PubChem (NCBI)