CAS 14009-70-2 appears in our catalog under these names: Levonorgestrel EP Impurity V (Aromatic Levonorgestrel), Levonorgestrel EP Impurity V, Levonorgestrel Impurity 22(Levonorgestrel EP Impurity V), 18-Methyl Mestranol, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(8R,9S,14S)-13-ethyl-17-ethynyl-3-methoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (CAS 14009-70-2) is a chemical compound with the molecular formula C22H28O2 and a molecular weight of 324.5 g/mol. IUPAC name: (8R,9S,14S)-13-ethyl-17-ethynyl-3-methoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol. InChIKey: NXKYEZGQCNWQRT-SPQGHWSVSA-N.
| Molecular formula | C22H28O2 |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | (8R,9S,14S)-13-ethyl-17-ethynyl-3-methoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| InChIKey | NXKYEZGQCNWQRT-SPQGHWSVSA-N |
| SMILES | CCC12CC[C@H]3[C@H]([C@@H]1CCC2(C#C)O)CCC4=C3C=CC(=C4)OC |
Computed by PubChem (NCBI)