CAS 1401091-28-8 is the registry number for Ethyl 2-(2-(4-fluorophenyl)thiazol-4-yl)-2-methylpropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoate (CAS 1401091-28-8) is a chemical compound with the molecular formula C15H16FNO2S and a molecular weight of 293.4 g/mol. IUPAC name: ethyl 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoate. InChIKey: XARRDOFGRYXMLR-UHFFFAOYSA-N.
| Molecular formula | C15H16FNO2S |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | ethyl 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoate |
| InChIKey | XARRDOFGRYXMLR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)C1=CSC(=N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)