CAS 1401103-23-8 is the registry number for 2-Bromo-1-(morpholin-4-yl)(2h2)ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-bromo-2,2-dideuterio-1-morpholin-4-ylethanone (CAS 1401103-23-8) is a chemical compound with the molecular formula C6H10BrNO2 and a molecular weight of 210.07 g/mol. IUPAC name: 2-bromo-2,2-dideuterio-1-morpholin-4-ylethanone. InChIKey: LLLQAMNGYJQUKK-BFWBPSQCSA-N.
| Molecular formula | C6H10BrNO2 |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 2-bromo-2,2-dideuterio-1-morpholin-4-ylethanone |
| InChIKey | LLLQAMNGYJQUKK-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C(=O)N1CCOCC1)Br |
Computed by PubChem (NCBI)