CAS 1401163-85-6 appears in our catalog under these names: 2-(2,2,2-Trifluoroethoxy)pyrimidine-5-boronic acid, 95%, (2-(2,2,2-Trifluoroethoxy)pyrimidin-5-yl)boronic acid 98%, (2-(2,2,2-Trifluoroethoxy)pyrimidin-5-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g.
[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]boronic acid (CAS 1401163-85-6) is a chemical compound with the molecular formula C6H6BF3N2O3 and a molecular weight of 221.93 g/mol. IUPAC name: [2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]boronic acid. InChIKey: AQKQSXGEHZAYIS-UHFFFAOYSA-N.
| Molecular formula | C6H6BF3N2O3 |
|---|---|
| Molecular weight | 221.93 g/mol |
| IUPAC name | [2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]boronic acid |
| InChIKey | AQKQSXGEHZAYIS-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)