CAS 1401348-38-6 is the registry number for 2-Chloro-6-(4,4-difluoropiperidin-1-yl)pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-6-(4,4-difluoropiperidin-1-yl)pyrazine (CAS 1401348-38-6) is a chemical compound with the molecular formula C9H10ClF2N3 and a molecular weight of 233.64 g/mol. IUPAC name: 2-chloro-6-(4,4-difluoropiperidin-1-yl)pyrazine. InChIKey: AZDBZRSVBBQAQD-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N3 |
|---|---|
| Molecular weight | 233.64 g/mol |
| IUPAC name | 2-chloro-6-(4,4-difluoropiperidin-1-yl)pyrazine |
| InChIKey | AZDBZRSVBBQAQD-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)C2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)