CAS 1401423-49-1 is the registry number for 5-Fluoro-2-methoxy-4-(methylsulfonyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-2-methoxy-4-methylsulfonylaniline (CAS 1401423-49-1) is a chemical compound with the molecular formula C8H10FNO3S and a molecular weight of 219.24 g/mol. IUPAC name: 5-fluoro-2-methoxy-4-methylsulfonylaniline. InChIKey: WAPZKGDRRMEHCQ-UHFFFAOYSA-N.
| Molecular formula | C8H10FNO3S |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5-fluoro-2-methoxy-4-methylsulfonylaniline |
| InChIKey | WAPZKGDRRMEHCQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1N)F)S(=O)(=O)C |
Computed by PubChem (NCBI)