Products 1401425-20-4

CAS 1401425-20-4 is the registry number for 1-(4H-1,2,4-Triazol-3-ylmethyl)piperazine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(1H-1,2,4-triazol-5-ylmethyl)piperazine;dihydrochloride (CAS 1401425-20-4) is a chemical compound with the molecular formula C7H15Cl2N5 and a molecular weight of 240.13 g/mol. IUPAC name: 1-(1H-1,2,4-triazol-5-ylmethyl)piperazine;dihydrochloride. InChIKey: WSTXOCOQYJITOL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15Cl2N5
Molecular weight240.13 g/mol
IUPAC name1-(1H-1,2,4-triazol-5-ylmethyl)piperazine;dihydrochloride
InChIKeyWSTXOCOQYJITOL-UHFFFAOYSA-N
SMILESC1CN(CCN1)CC2=NC=NN2.Cl.Cl

Computed by PubChem (NCBI)