CAS 1401425-33-9 is the registry number for Sodium 2-methoxy-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Sodium 2-methoxy-1,3-thiazole-5-carboxylate (CAS 1401425-33-9) is a chemical compound with the molecular formula C5H4NNaO3S and a molecular weight of 181.15 g/mol. IUPAC name: sodium 2-methoxy-1,3-thiazole-5-carboxylate. InChIKey: BVEQLACUVYMNGW-UHFFFAOYSA-M.
| Molecular formula | C5H4NNaO3S |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | sodium 2-methoxy-1,3-thiazole-5-carboxylate |
| InChIKey | BVEQLACUVYMNGW-UHFFFAOYSA-M |
| SMILES | COC1=NC=C(S1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)