CAS 1401463-54-4 appears in our catalog under these names: BAN ORL 24, 98+%, BAN ORL 24/ 95.03% (existing batch purity), BAN ORL 24 (hydrochloride), BAN ORL 24, BAN ORL 24, 99.68%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 100mg, 10mg, 2mg, 5mg, 25mg, 5 mg, 10mM/1mL.
(2R)-1-benzyl-N-(3-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylpropyl)pyrrolidine-2-carboxamide;dihydrochloride (CAS 1401463-54-4) is a chemical compound with the molecular formula C27H37Cl2N3O2 and a molecular weight of 506.5 g/mol. IUPAC name: (2R)-1-benzyl-N-(3-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylpropyl)pyrrolidine-2-carboxamide;dihydrochloride. InChIKey: NEEVITHVDIQNJY-KHZPMNTOSA-N.
| Molecular formula | C27H37Cl2N3O2 |
|---|---|
| Molecular weight | 506.5 g/mol |
| IUPAC name | (2R)-1-benzyl-N-(3-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylpropyl)pyrrolidine-2-carboxamide;dihydrochloride |
| InChIKey | NEEVITHVDIQNJY-KHZPMNTOSA-N |
| SMILES | C1C[C@@H](N(C1)CC2=CC=CC=C2)C(=O)NCCCN3CCC4(CC3)C5=CC=CC=C5CO4.Cl.Cl |
Computed by PubChem (NCBI)