CAS 1401522-75-5 is the registry number for Potassium 3,4-dibromo-2-thienyltrifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
Potassium (3,4-dibromothiophen-2-yl)-trifluoroboranuide (CAS 1401522-75-5) is a chemical compound with the molecular formula C4HBBr2F3KS and a molecular weight of 347.83 g/mol. IUPAC name: potassium (3,4-dibromothiophen-2-yl)-trifluoroboranuide. InChIKey: LLEFLGJXGDTQJT-UHFFFAOYSA-N.
| Molecular formula | C4HBBr2F3KS |
|---|---|
| Molecular weight | 347.83 g/mol |
| IUPAC name | potassium (3,4-dibromothiophen-2-yl)-trifluoroboranuide |
| InChIKey | LLEFLGJXGDTQJT-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C(=CS1)Br)Br)(F)(F)F.[K+] |
Computed by PubChem (NCBI)