CAS 1401602-65-0 is the registry number for 2-Amino-6-methyl-5-(piperazin-1-yl)pyrimidin-4(3H)-one dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4-methyl-5-piperazin-1-yl-1H-pyrimidin-6-one;dihydrochloride (CAS 1401602-65-0) is a chemical compound with the molecular formula C9H17Cl2N5O and a molecular weight of 282.17 g/mol. IUPAC name: 2-amino-4-methyl-5-piperazin-1-yl-1H-pyrimidin-6-one;dihydrochloride. InChIKey: DQVZWOWLGPDTRD-UHFFFAOYSA-N.
| Molecular formula | C9H17Cl2N5O |
|---|---|
| Molecular weight | 282.17 g/mol |
| IUPAC name | 2-amino-4-methyl-5-piperazin-1-yl-1H-pyrimidin-6-one;dihydrochloride |
| InChIKey | DQVZWOWLGPDTRD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=N1)N)N2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)