CAS 140164-85-8 appears in our catalog under these names: Nbd-cocl, 95%, NBD-COCl [=4-(N-Chloroformylmethyl-N-methylamino)-7-nitro-2,1,3-benzoxadiazole] [for HPLC Labeling], >92.0%(T). Offered by: Combi-blocks, TCI. Available pack sizes: 100mg.
2-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]acetyl chloride (CAS 140164-85-8) is a chemical compound with the molecular formula C9H7ClN4O4 and a molecular weight of 270.63 g/mol. IUPAC name: 2-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]acetyl chloride. InChIKey: BLKGIXBLRWZLKS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN4O4 |
|---|---|
| Molecular weight | 270.63 g/mol |
| IUPAC name | 2-[methyl-(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]acetyl chloride |
| InChIKey | BLKGIXBLRWZLKS-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)Cl)C1=CC=C(C2=NON=C12)[N+](=O)[O-] |
Computed by PubChem (NCBI)