Products 1401665-21-1
CAS 1401665-21-1 is the registry number for (S)-2-Amino-1-((R)-3-bromo-pyrrolidin-1-yl)-propan-1-one. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
(2S)-2-amino-1-[(3R)-3-bromopyrrolidin-1-yl]propan-1-one (CAS 1401665-21-1) is a chemical compound with the molecular formula C7H13BrN2O and a molecular weight of 221.09 g/mol. IUPAC name: (2S)-2-amino-1-[(3R)-3-bromopyrrolidin-1-yl]propan-1-one. InChIKey: DGGHZSBIWNCEJI-NTSWFWBYSA-N.
| Molecular formula | C7H13BrN2O |
|---|---|
| Molecular weight | 221.09 g/mol |
| IUPAC name | (2S)-2-amino-1-[(3R)-3-bromopyrrolidin-1-yl]propan-1-one |
| InChIKey | DGGHZSBIWNCEJI-NTSWFWBYSA-N |
| SMILES | C[C@@H](C(=O)N1CC[C@H](C1)Br)N |
Computed by PubChem (NCBI)