CAS 1401665-37-9 is the registry number for (S)-2-Amino-1-((R)-3-(benzyl(cyclopropyl)amino)pyrrolidin-1-yl)propan-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-1-[(3R)-3-[benzyl(cyclopropyl)amino]pyrrolidin-1-yl]propan-1-one (CAS 1401665-37-9) is a chemical compound with the molecular formula C17H25N3O and a molecular weight of 287.4 g/mol. IUPAC name: (2S)-2-amino-1-[(3R)-3-[benzyl(cyclopropyl)amino]pyrrolidin-1-yl]propan-1-one. InChIKey: CIASLNONSWAZDC-XJKSGUPXSA-N.
| Molecular formula | C17H25N3O |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (2S)-2-amino-1-[(3R)-3-[benzyl(cyclopropyl)amino]pyrrolidin-1-yl]propan-1-one |
| InChIKey | CIASLNONSWAZDC-XJKSGUPXSA-N |
| SMILES | C[C@@H](C(=O)N1CC[C@H](C1)N(CC2=CC=CC=C2)C3CC3)N |
Computed by PubChem (NCBI)