Products 1401665-89-1
CAS 1401665-89-1 is the registry number for (S)-2-Amino-1-((S)-3-(dimethylamino)pyrrolidin-1-yl)propan-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-1-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]propan-1-one (CAS 1401665-89-1) is a chemical compound with the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. IUPAC name: (2S)-2-amino-1-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]propan-1-one. InChIKey: CLGAHSYZQGFOHM-YUMQZZPRSA-N.
| Molecular formula | C9H19N3O |
|---|---|
| Molecular weight | 185.27 g/mol |
| IUPAC name | (2S)-2-amino-1-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]propan-1-one |
| InChIKey | CLGAHSYZQGFOHM-YUMQZZPRSA-N |
| SMILES | C[C@@H](C(=O)N1CC[C@@H](C1)N(C)C)N |
Computed by PubChem (NCBI)