Products 1401728-56-0
CAS 1401728-56-0 appears in our catalog under these names: NE 52-QQ57, 96%, NE 52-QQ57/ 99.93% (existing batch purity), NE 52–QQ57, NE 52-QQ57, NE 52-QQ57 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg.
2-[4-[(2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]phenyl]-5-piperidin-4-yl-1,3,4-oxadiazole (CAS 1401728-56-0) is a chemical compound with the molecular formula C24H28N6O and a molecular weight of 416.5 g/mol. IUPAC name: 2-[4-[(2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]phenyl]-5-piperidin-4-yl-1,3,4-oxadiazole. InChIKey: HXPQWNPLNIEJOW-UHFFFAOYSA-N.
| Molecular formula | C24H28N6O |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 2-[4-[(2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]phenyl]-5-piperidin-4-yl-1,3,4-oxadiazole |
| InChIKey | HXPQWNPLNIEJOW-UHFFFAOYSA-N |
| SMILES | CCC1=NN2C(=CC(=NC2=C1CC3=CC=C(C=C3)C4=NN=C(O4)C5CCNCC5)C)C |
Computed by PubChem (NCBI)