CAS 1401728-86-6 is the registry number for 4-((2-Ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]benzoic acid (CAS 1401728-86-6) is a chemical compound with the molecular formula C18H19N3O2 and a molecular weight of 309.4 g/mol. IUPAC name: 4-[(2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]benzoic acid. InChIKey: XFWVGGPWIDWSEX-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O2 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 4-[(2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]benzoic acid |
| InChIKey | XFWVGGPWIDWSEX-UHFFFAOYSA-N |
| SMILES | CCC1=NN2C(=CC(=NC2=C1CC3=CC=C(C=C3)C(=O)O)C)C |
Computed by PubChem (NCBI)