CAS 140192-89-8 is the registry number for Isoquinoline-5,6-diamine. Offered by: TRC. Available pack sizes: 250mg.
Isoquinoline-5,6-diamine (CAS 140192-89-8) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: isoquinoline-5,6-diamine. InChIKey: IXGBYFWUZTWDPJ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | isoquinoline-5,6-diamine |
| InChIKey | IXGBYFWUZTWDPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=NC=C2)N)N |
Computed by PubChem (NCBI)