Products 1402082-40-9

CAS 1402082-40-9 is the registry number for 2-(4-Fluorophenoxy)pyridine-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-fluorophenoxy)pyridine-3-sulfonyl chloride (CAS 1402082-40-9) is a chemical compound with the molecular formula C11H7ClFNO3S and a molecular weight of 287.69 g/mol. IUPAC name: 2-(4-fluorophenoxy)pyridine-3-sulfonyl chloride. InChIKey: HIODABLDHXBFIF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClFNO3S
Molecular weight287.69 g/mol
IUPAC name2-(4-fluorophenoxy)pyridine-3-sulfonyl chloride
InChIKeyHIODABLDHXBFIF-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)OC2=CC=C(C=C2)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)