CAS 1402163-95-4 is the registry number for (S)-3-Hydroxyisobutyric Acid Potassium Salt. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Potassium (2S)-3-hydroxy-2-methylpropanoate (CAS 1402163-95-4) is a chemical compound with the molecular formula C4H7KO3 and a molecular weight of 142.19 g/mol. IUPAC name: potassium (2S)-3-hydroxy-2-methylpropanoate. InChIKey: GYLUDEIOSIWODS-DFWYDOINSA-M.
| Molecular formula | C4H7KO3 |
|---|---|
| Molecular weight | 142.19 g/mol |
| IUPAC name | potassium (2S)-3-hydroxy-2-methylpropanoate |
| InChIKey | GYLUDEIOSIWODS-DFWYDOINSA-M |
| SMILES | C[C@@H](CO)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)