Products 1402166-63-5
CAS 1402166-63-5 is the registry number for N–(2–Acetoxyethyl)–2–methylimidazole–4–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-1-yl]ethyl acetate (CAS 1402166-63-5) is a chemical compound with the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. IUPAC name: 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-1-yl]ethyl acetate. InChIKey: JKUNHASFWBRVTR-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4 |
|---|---|
| Molecular weight | 294.16 g/mol |
| IUPAC name | 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-1-yl]ethyl acetate |
| InChIKey | JKUNHASFWBRVTR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C(=N2)C)CCOC(=O)C |
Computed by PubChem (NCBI)