Products 1402225-86-8

CAS 1402225-86-8 is the registry number for B-[1,1′:3′,1′′:3′′,1′′′-Quaterphenyl]-4-ylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-[3-(3-phenylphenyl)phenyl]phenyl]boronic acid (CAS 1402225-86-8) is a chemical compound with the molecular formula C24H19BO2 and a molecular weight of 350.2 g/mol. IUPAC name: [4-[3-(3-phenylphenyl)phenyl]phenyl]boronic acid. InChIKey: RASMFOGWZBHTFS-UHFFFAOYSA-N.

Identity
Molecular formulaC24H19BO2
Molecular weight350.2 g/mol
IUPAC name[4-[3-(3-phenylphenyl)phenyl]phenyl]boronic acid
InChIKeyRASMFOGWZBHTFS-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=CC(=C3)C4=CC=CC=C4)(O)O

Computed by PubChem (NCBI)