CAS 1402225-86-8 is the registry number for B-[1,1′:3′,1′′:3′′,1′′′-Quaterphenyl]-4-ylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-[3-(3-phenylphenyl)phenyl]phenyl]boronic acid (CAS 1402225-86-8) is a chemical compound with the molecular formula C24H19BO2 and a molecular weight of 350.2 g/mol. IUPAC name: [4-[3-(3-phenylphenyl)phenyl]phenyl]boronic acid. InChIKey: RASMFOGWZBHTFS-UHFFFAOYSA-N.
| Molecular formula | C24H19BO2 |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | [4-[3-(3-phenylphenyl)phenyl]phenyl]boronic acid |
| InChIKey | RASMFOGWZBHTFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=CC(=C3)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)