CAS 491612-72-7 is the registry number for (5'-Phenyl-[1,1':3',1''-terphenyl]-4-yl)boronic acid, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(3,5-diphenylphenyl)phenyl]boronic acid (CAS 491612-72-7) is a chemical compound with the molecular formula C24H19BO2 and a molecular weight of 350.2 g/mol. IUPAC name: [4-(3,5-diphenylphenyl)phenyl]boronic acid. InChIKey: QNUFXOKVLKCBFV-UHFFFAOYSA-N.
| Molecular formula | C24H19BO2 |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | [4-(3,5-diphenylphenyl)phenyl]boronic acid |
| InChIKey | QNUFXOKVLKCBFV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=CC=C3)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)