CAS 1402227-73-9 is the registry number for 5–(4–Fluoro–2–methylphenyl)thiophene–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-[5-(4-fluoro-2-methylphenyl)thiophen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1402227-73-9) is a chemical compound with the molecular formula C17H20BFO2S and a molecular weight of 318.2 g/mol. IUPAC name: 2-[5-(4-fluoro-2-methylphenyl)thiophen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XMAAORPOHQQWQH-UHFFFAOYSA-N.
| Molecular formula | C17H20BFO2S |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 2-[5-(4-fluoro-2-methylphenyl)thiophen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XMAAORPOHQQWQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=C(C=C(C=C3)F)C |
Computed by PubChem (NCBI)