CAS 1402232-75-0 is the registry number for 3-Fluoro-4-((3-methyloxetan-3-yl)methoxy)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-fluoro-4-[(3-methyloxetan-3-yl)methoxy]benzoic acid (CAS 1402232-75-0) is a chemical compound with the molecular formula C12H13FO4 and a molecular weight of 240.23 g/mol. IUPAC name: 3-fluoro-4-[(3-methyloxetan-3-yl)methoxy]benzoic acid. InChIKey: KJINDCACIYIRJB-UHFFFAOYSA-N.
| Molecular formula | C12H13FO4 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 3-fluoro-4-[(3-methyloxetan-3-yl)methoxy]benzoic acid |
| InChIKey | KJINDCACIYIRJB-UHFFFAOYSA-N |
| SMILES | CC1(COC1)COC2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)