Products 1402238-36-1

CAS 1402238-36-1 is the registry number for 2-Methyl-4-sulfamoylphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

(2-methyl-4-sulfamoylphenyl)boronic acid (CAS 1402238-36-1) is a chemical compound with the molecular formula C7H10BNO4S and a molecular weight of 215.04 g/mol. IUPAC name: (2-methyl-4-sulfamoylphenyl)boronic acid. InChIKey: BSLOFCDDCNUTDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO4S
Molecular weight215.04 g/mol
IUPAC name(2-methyl-4-sulfamoylphenyl)boronic acid
InChIKeyBSLOFCDDCNUTDZ-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)S(=O)(=O)N)C)(O)O

Computed by PubChem (NCBI)