Products 1402242-53-8
CAS 1402242-53-8 appears in our catalog under these names: Acetyllycoposerramine M, Acetyllycoposerramine M, Acetyllycoposerramine M, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 1 mg, 5 mg, 10mg.
[(1R,2R,3S,10S,13S,15R)-15-methyl-11-oxo-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-3-yl] acetate (CAS 1402242-53-8) is a chemical compound with the molecular formula C18H27NO3 and a molecular weight of 305.4 g/mol. IUPAC name: [(1R,2R,3S,10S,13S,15R)-15-methyl-11-oxo-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-3-yl] acetate. InChIKey: KHPXQJZHVIQFTG-YSDJCCEOSA-N.
| Molecular formula | C18H27NO3 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | [(1R,2R,3S,10S,13S,15R)-15-methyl-11-oxo-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-3-yl] acetate |
| InChIKey | KHPXQJZHVIQFTG-YSDJCCEOSA-N |
| SMILES | C[C@@H]1C[C@H]2CC(=O)[C@H]3CCCN4[C@]3(C1)[C@@H]2[C@H](CC4)OC(=O)C |
Computed by PubChem (NCBI)