CAS 14024-17-0 appears in our catalog under these names: Ferrous acetylacetonate, 97%, Iron(II) acetylacetonate, Iron(II) acetylacetonate, Fe(acac)2 95%, Iron(II) acetylacetonate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 100g, 500g, 25g, 1g, 250g, 1000g, 10g.
Bis((Z)-4-hydroxypent-3-en-2-one);iron (CAS 14024-17-0) is a chemical compound with the molecular formula C10H16FeO4 and a molecular weight of 256.08 g/mol. IUPAC name: bis((Z)-4-hydroxypent-3-en-2-one);iron. InChIKey: LFKXWKGYHQXRQA-FDGPNNRMSA-N.
| Molecular formula | C10H16FeO4 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | bis((Z)-4-hydroxypent-3-en-2-one);iron |
| InChIKey | LFKXWKGYHQXRQA-FDGPNNRMSA-N |
| SMILES | C/C(=C/C(=O)C)/O.C/C(=C/C(=O)C)/O.[Fe] |
Computed by PubChem (NCBI)