Products 1402547-47-0

CAS 1402547-47-0 is the registry number for EET analog 7. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

(2S)-2-[[(Z)-13-(pentylcarbamoylamino)tridec-8-enoyl]amino]butanedioic acid (CAS 1402547-47-0) is a chemical compound with the molecular formula C23H41N3O6 and a molecular weight of 455.6 g/mol. IUPAC name: (2S)-2-[[(Z)-13-(pentylcarbamoylamino)tridec-8-enoyl]amino]butanedioic acid. InChIKey: RLAXHUGRQALCNK-WPGJWXSHSA-N.

Identity
Molecular formulaC23H41N3O6
Molecular weight455.6 g/mol
IUPAC name(2S)-2-[[(Z)-13-(pentylcarbamoylamino)tridec-8-enoyl]amino]butanedioic acid
InChIKeyRLAXHUGRQALCNK-WPGJWXSHSA-N
SMILESCCCCCNC(=O)NCCCC/C=C\CCCCCCC(=O)N[C@@H](CC(=O)O)C(=O)O

Computed by PubChem (NCBI)

Synonyms: orb3174604