CAS 1402818-99-8 is the registry number for hURAT1 inhibitor 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-6-fluoro-1-benzofuran-3-yl)methanone (CAS 1402818-99-8) is a chemical compound with the molecular formula C17H11Br2FO3 and a molecular weight of 442.1 g/mol. IUPAC name: (3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-6-fluoro-1-benzofuran-3-yl)methanone. InChIKey: GIVTUZFBWDBWTM-UHFFFAOYSA-N.
| Molecular formula | C17H11Br2FO3 |
|---|---|
| Molecular weight | 442.1 g/mol |
| IUPAC name | (3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-6-fluoro-1-benzofuran-3-yl)methanone |
| InChIKey | GIVTUZFBWDBWTM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(O1)C=C(C=C2)F)C(=O)C3=CC(=C(C(=C3)Br)O)Br |
Computed by PubChem (NCBI)