Products 14030-71-8
CAS 14030-71-8 is the registry number for Nitazene, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
2-(2-benzyl-5-nitrobenzimidazol-1-yl)-N,N-diethylethanamine (CAS 14030-71-8) is a chemical compound with the molecular formula C20H24N4O2 and a molecular weight of 352.4 g/mol. IUPAC name: 2-(2-benzyl-5-nitrobenzimidazol-1-yl)-N,N-diethylethanamine. InChIKey: BZQKWBWRXLMPAA-UHFFFAOYSA-N.
| Molecular formula | C20H24N4O2 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 2-(2-benzyl-5-nitrobenzimidazol-1-yl)-N,N-diethylethanamine |
| InChIKey | BZQKWBWRXLMPAA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CC3=CC=CC=C3 |
Computed by PubChem (NCBI)