Products 14031-37-9
CAS 14031-37-9 appears in our catalog under these names: Squalene-2,3-glycol, Squalene-2,3-diol, 93%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 1mg.
(6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18,22-pentaene-2,3-diol (CAS 14031-37-9) is a chemical compound with the molecular formula C30H52O2 and a molecular weight of 444.7 g/mol. IUPAC name: (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18,22-pentaene-2,3-diol. InChIKey: GRPNWQFOKYUABH-BANQPHDMSA-N.
| Molecular formula | C30H52O2 |
|---|---|
| Molecular weight | 444.7 g/mol |
| IUPAC name | (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-6,10,14,18,22-pentaene-2,3-diol |
| InChIKey | GRPNWQFOKYUABH-BANQPHDMSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C=C(\C)/CC/C=C(\C)/CCC(C(C)(C)O)O)/C)/C)C |
Computed by PubChem (NCBI)