CAS 1403458-27-4 is the registry number for (S)-PI3K-IN-2, 99.50%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 100 mg, 5 mg, 25 mg, 50 mg, 10 mg.
8-[(2S)-1-(3,5-difluorophenyl)pyrrolidin-2-yl]-6-(morpholine-4-carbonyl)-2-morpholin-4-ylchromen-4-one (CAS 1403458-27-4) is a chemical compound with the molecular formula C28H29F2N3O5 and a molecular weight of 525.5 g/mol. IUPAC name: 8-[(2S)-1-(3,5-difluorophenyl)pyrrolidin-2-yl]-6-(morpholine-4-carbonyl)-2-morpholin-4-ylchromen-4-one. InChIKey: CPFXYHKMOTWOFK-DEOSSOPVSA-N.
| Molecular formula | C28H29F2N3O5 |
|---|---|
| Molecular weight | 525.5 g/mol |
| IUPAC name | 8-[(2S)-1-(3,5-difluorophenyl)pyrrolidin-2-yl]-6-(morpholine-4-carbonyl)-2-morpholin-4-ylchromen-4-one |
| InChIKey | CPFXYHKMOTWOFK-DEOSSOPVSA-N |
| SMILES | C1C[C@H](N(C1)C2=CC(=CC(=C2)F)F)C3=CC(=CC4=C3OC(=CC4=O)N5CCOCC5)C(=O)N6CCOCC6 |
Computed by PubChem (NCBI)