CAS 1403474-76-9 appears in our catalog under these names: Azilsartan Impurity 42, Azilsartan Impurity 20, Azilsartan Impurity 7. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
Ethyl 2-oxo-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate (CAS 1403474-76-9) is a chemical compound with the molecular formula C25H20N4O5 and a molecular weight of 456.4 g/mol. IUPAC name: ethyl 2-oxo-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate. InChIKey: DXBRZLXNEVZKGS-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O5 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | ethyl 2-oxo-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate |
| InChIKey | DXBRZLXNEVZKGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=CC=C1)NC(=O)N2CC3=CC=C(C=C3)C4=CC=CC=C4C5=NOC(=O)N5 |
Computed by PubChem (NCBI)