CAS 1403483-57-7 is the registry number for N-Cyclopentyl 4-bromo-2-fluorobenzylamine hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[(4-bromo-2-fluorophenyl)methyl]cyclopentanamine;hydrochloride (CAS 1403483-57-7) is a chemical compound with the molecular formula C12H16BrClFN and a molecular weight of 308.62 g/mol. IUPAC name: N-[(4-bromo-2-fluorophenyl)methyl]cyclopentanamine;hydrochloride. InChIKey: DSJPAIUGIRTPQH-UHFFFAOYSA-N.
| Molecular formula | C12H16BrClFN |
|---|---|
| Molecular weight | 308.62 g/mol |
| IUPAC name | N-[(4-bromo-2-fluorophenyl)methyl]cyclopentanamine;hydrochloride |
| InChIKey | DSJPAIUGIRTPQH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NCC2=C(C=C(C=C2)Br)F.Cl |
Computed by PubChem (NCBI)