Products 1403483-61-3
CAS 1403483-61-3 is the registry number for 1-Bromo-2-methanesulfonyl-4-nitro-5-(trifluoromethoxy)benzene, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
1-bromo-2-methylsulfonyl-4-nitro-5-(trifluoromethoxy)benzene (CAS 1403483-61-3) is a chemical compound with the molecular formula C8H5BrF3NO5S and a molecular weight of 364.10 g/mol. IUPAC name: 1-bromo-2-methylsulfonyl-4-nitro-5-(trifluoromethoxy)benzene. InChIKey: KCHRASZRDOIERM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO5S |
|---|---|
| Molecular weight | 364.10 g/mol |
| IUPAC name | 1-bromo-2-methylsulfonyl-4-nitro-5-(trifluoromethoxy)benzene |
| InChIKey | KCHRASZRDOIERM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C(=C1)[N+](=O)[O-])OC(F)(F)F)Br |
Computed by PubChem (NCBI)