CAS 1403483-77-1 appears in our catalog under these names: N-(2-Chloro-6-methoxycarbonylphenyl)methyl phthamide, 97%, Methyl 3-chloro-2-((1,3-dioxoisoindolin-2-yl)methyl)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 3-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (CAS 1403483-77-1) is a chemical compound with the molecular formula C17H12ClNO4 and a molecular weight of 329.7 g/mol. IUPAC name: methyl 3-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]benzoate. InChIKey: MZUPYWJJMSUZBR-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO4 |
|---|---|
| Molecular weight | 329.7 g/mol |
| IUPAC name | methyl 3-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| InChIKey | MZUPYWJJMSUZBR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Cl)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)