CAS 1403495-37-3 is the registry number for 1-(4-Bromophenyl)-2,3,4,5-tetraphenyl-1H-pyrrole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromophenyl)-2,3,4,5-tetraphenylpyrrole (CAS 1403495-37-3) is a chemical compound with the molecular formula C34H24BrN and a molecular weight of 526.5 g/mol. IUPAC name: 1-(4-bromophenyl)-2,3,4,5-tetraphenylpyrrole. InChIKey: YSBCSGCMFBMERP-UHFFFAOYSA-N.
| Molecular formula | C34H24BrN |
|---|---|
| Molecular weight | 526.5 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,3,4,5-tetraphenylpyrrole |
| InChIKey | YSBCSGCMFBMERP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N(C(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=C(C=C5)Br)C6=CC=CC=C6 |
Computed by PubChem (NCBI)