Products 1403496-40-1
CAS 1403496-40-1 appears in our catalog under these names: Fotagliptin benzoate, Fotagliptin (benzoate), 99.19%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg, 50 mg, 100 mg, 10mM/1mL.
2-[[3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-5-oxo-1,2,4-triazin-4-yl]methyl]-4-fluorobenzonitrile;benzoic acid (CAS 1403496-40-1) is a chemical compound with the molecular formula C24H25FN6O3 and a molecular weight of 464.5 g/mol. IUPAC name: 2-[[3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-5-oxo-1,2,4-triazin-4-yl]methyl]-4-fluorobenzonitrile;benzoic acid. InChIKey: CEIKPTLXEHWGMB-XFULWGLBSA-N.
| Molecular formula | C24H25FN6O3 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | 2-[[3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-5-oxo-1,2,4-triazin-4-yl]methyl]-4-fluorobenzonitrile;benzoic acid |
| InChIKey | CEIKPTLXEHWGMB-XFULWGLBSA-N |
| SMILES | CC1=NN=C(N(C1=O)CC2=C(C=CC(=C2)F)C#N)N3CCC[C@H](C3)N.C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)